C32H32N4O5S — CID 124535353
2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124535353) has the molecular formula C32H32N4O5S and a molecular weight of 584.70 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124535353 |
| Molecular Formula | C32H32N4O5S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)CN(c3ccc(C)c(C)c3)S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H32N4O5S/c1-23-9-14-27(15-10-23)34-32(38)22-41-29-17-12-26(13-18-29)20-33-35-31(37)21-36(28-16-11-24(2)25(3)19-28)42(39,40)30-7-5-4-6-8-30/h4-20H,21-22H2,1-3H3,(H,34,38)(H,35,37)/b33-20- |
| InChIKey | JAEJRNWNOURRSL-UCMJSZAQSA-N |
| XLogP | 4.97 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|