C31H29BrN4O5S — CID 124596762
2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124596762) has the molecular formula C31H29BrN4O5S and a molecular weight of 649.57 g/mol. Its IUPAC name is 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124596762 |
| Molecular Formula | C31H29BrN4O5S |
| Molecular Weight | 649.57 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)CN(c3ccc(Br)cc3)S(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H29BrN4O5S/c1-22-3-11-26(12-4-22)34-31(38)21-41-28-15-7-24(8-16-28)19-33-35-30(37)20-36(27-13-9-25(32)10-14-27)42(39,40)29-17-5-23(2)6-18-29/h3-19H,20-21H2,1-2H3,(H,34,38)(H,35,37)/b33-19- |
| InChIKey | BBLARNSVGZICQK-APTWKGOFSA-N |
| XLogP | 5.43 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|