C31H29FN4O6S — CID 43880767
N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 43880767) has the molecular formula C31H29FN4O6S and a molecular weight of 604.66 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43880767 |
| Molecular Formula | C31H29FN4O6S |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)N/N=C/c1ccc(OCC(=O)Nc2ccc(F)cc2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H29FN4O6S/c1-22-7-17-27(18-8-22)43(39,40)36(28-5-3-4-6-29(28)41-2)20-30(37)35-33-19-23-9-15-26(16-10-23)42-21-31(38)34-25-13-11-24(32)12-14-25/h3-19H,20-21H2,1-2H3,(H,34,38)(H,35,37)/b33-19+ |
| InChIKey | JOKUSZVTWCUXNZ-HNSNBQBZSA-N |
| XLogP | 4.51 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|