C33H34N4O6S — CID 126034996
2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126034996) has the molecular formula C33H34N4O6S and a molecular weight of 614.72 g/mol. Its IUPAC name is 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126034996 |
| Molecular Formula | C33H34N4O6S |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)CN(c3cccc(C)c3C)S(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O6S/c1-23-8-18-30(19-9-23)44(40,41)37(31-7-5-6-24(2)25(31)3)21-32(38)36-34-20-26-10-14-29(15-11-26)43-22-33(39)35-27-12-16-28(42-4)17-13-27/h5-20H,21-22H2,1-4H3,(H,35,39)(H,36,38)/b34-20- |
| InChIKey | OTWMKNIJROLKCZ-GXBUFBABSA-N |
| XLogP | 4.98 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|