C25H26N4O6S — CID 28589725
N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 28589725) has the molecular formula C25H26N4O6S and a molecular weight of 510.57 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28589725 |
| Molecular Formula | C25H26N4O6S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)N/N=C\c1ccc(OCC(N)=O)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H26N4O6S/c1-18-7-13-21(14-8-18)36(32,33)29(22-5-3-4-6-23(22)34-2)16-25(31)28-27-15-19-9-11-20(12-10-19)35-17-24(26)30/h3-15H,16-17H2,1-2H3,(H2,26,30)(H,28,31)/b27-15- |
| InChIKey | VEHXOYAGMQWKOC-DICXZTSXSA-N |
| XLogP | 2.21 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|