C30H34N4O7S — CID 43881252
2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 43881252) has the molecular formula C30H34N4O7S and a molecular weight of 594.69 g/mol. Its IUPAC name is 2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 43881252 |
| Molecular Formula | C30H34N4O7S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccccc1N(CC(=O)N/N=C/c1ccc(OCC(=O)NCC2CCCO2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H34N4O7S/c1-22-9-15-26(16-10-22)42(37,38)34(27-7-3-4-8-28(27)39-2)20-29(35)33-32-18-23-11-13-24(14-12-23)41-21-30(36)31-19-25-6-5-17-40-25/h3-4,7-16,18,25H,5-6,17,19-21H2,1-2H3,(H,31,36)(H,33,35)/b32-18+ |
| InChIKey | AVJTTWZTNVHBSR-KCSSXMTESA-N |
| XLogP | 3.02 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|