C31H36N4O7S — CID 124539686
2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124539686) has the molecular formula C31H36N4O7S and a molecular weight of 608.72 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124539686 |
| Molecular Formula | C31H36N4O7S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2ccc(OCC(=O)NC[C@H]3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C31H36N4O7S/c1-40-26-13-15-29(16-14-26)43(38,39)35(18-17-24-6-3-2-4-7-24)22-30(36)34-33-20-25-9-11-27(12-10-25)42-23-31(37)32-21-28-8-5-19-41-28/h2-4,6-7,9-16,20,28H,5,8,17-19,21-23H2,1H3,(H,32,37)(H,34,36)/b33-20+/t28-/m1/s1 |
| InChIKey | IFJVMERSDDZBCS-RBVAJZFBSA-N |
| XLogP | 2.75 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|