C25H26BrN3O4S — CID 98083596
2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 98083596) has the molecular formula C25H26BrN3O4S and a molecular weight of 544.47 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98083596 |
| Molecular Formula | C25H26BrN3O4S |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H26BrN3O4S/c1-2-33-23-12-8-21(9-13-23)18-27-28-25(30)19-29(17-16-20-6-4-3-5-7-20)34(31,32)24-14-10-22(26)11-15-24/h3-15,18H,2,16-17,19H2,1H3,(H,28,30)/b27-18- |
| InChIKey | CBSDFHCIMXKIIS-IMRQLAEWSA-N |
| XLogP | 4.23 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|