C32H31FN4O6S — CID 98100472
N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 98100472) has the molecular formula C32H31FN4O6S and a molecular weight of 618.69 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 98100472 |
| Molecular Formula | C32H31FN4O6S |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | N-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2ccc(OCC(=O)Nc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H31FN4O6S/c1-42-28-15-17-30(18-16-28)44(40,41)37(20-19-24-5-3-2-4-6-24)22-31(38)36-34-21-25-7-13-29(14-8-25)43-23-32(39)35-27-11-9-26(33)10-12-27/h2-18,21H,19-20,22-23H2,1H3,(H,35,39)(H,36,38)/b34-21+ |
| InChIKey | FOAICNFAISXPMX-KEIPNQJHSA-N |
| XLogP | 4.24 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|