C34H35N5O6S — CID 99653408
2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 99653408) has the molecular formula C34H35N5O6S and a molecular weight of 641.75 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99653408 |
| Molecular Formula | C34H35N5O6S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2ccc(OCC(=O)Nc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H35N5O6S/c1-25-8-12-30(13-9-25)37-34(42)24-45-31-16-10-28(11-17-31)22-35-38-33(41)23-39(21-20-27-6-4-3-5-7-27)46(43,44)32-18-14-29(15-19-32)36-26(2)40/h3-19,22H,20-21,23-24H2,1-2H3,(H,36,40)(H,37,42)(H,38,41)/b35-22+ |
| InChIKey | UYPXTLWLNQUWRJ-FADJLKOXSA-N |
| XLogP | 4.35 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|