C27H24BrN3O3S — CID 6068631
2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide (PubChem CID 6068631) has the molecular formula C27H24BrN3O3S and a molecular weight of 550.48 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6068631 |
| Molecular Formula | C27H24BrN3O3S |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(CCc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H24BrN3O3S/c28-24-13-15-25(16-14-24)35(33,34)31(18-17-21-7-2-1-3-8-21)20-27(32)30-29-19-23-11-6-10-22-9-4-5-12-26(22)23/h1-16,19H,17-18,20H2,(H,30,32)/b29-19- |
| InChIKey | PGHFERRBDAWEFX-CEUNXORHSA-N |
| XLogP | 4.99 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|