C25H25N3O6S — CID 3525723
2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(2-phenylethyl)amino]-N-[(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 3525723) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(2-phenylethyl)amino]-N-[(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(2-phenylethyl)amino]-N-[(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3525723 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(2-phenylethyl)amino]-N-[(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(CCc1ccccc1)S(=O)(=O)c1ccc2c(c1)OCCO2)NN=Cc1ccccc1O |
| InChI | InChI=1S/C25H25N3O6S/c29-22-9-5-4-8-20(22)17-26-27-25(30)18-28(13-12-19-6-2-1-3-7-19)35(31,32)21-10-11-23-24(16-21)34-15-14-33-23/h1-11,16-17,29H,12-15,18H2,(H,27,30) |
| InChIKey | UXJHVXOCLIXZLG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|