C23H26N4O6 — CID 94832842
N-(4-methoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 94832842) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94832842 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)NC[C@H]3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O6/c1-31-18-10-6-17(7-11-18)26-22(29)23(30)27-25-13-16-4-8-19(9-5-16)33-15-21(28)24-14-20-3-2-12-32-20/h4-11,13,20H,2-3,12,14-15H2,1H3,(H,24,28)(H,26,29)(H,27,30)/b25-13-/t20-/m1/s1 |
| InChIKey | UMAFEEPYXIJWKV-KXQYWQJRSA-N |
| XLogP | 1.46 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|