C22H23ClN4O5 — CID 126273203
N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 126273203) has the molecular formula C22H23ClN4O5 and a molecular weight of 458.90 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126273203 |
| Molecular Formula | C22H23ClN4O5 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O5/c23-16-5-7-17(8-6-16)26-20(28)14-32-18-9-3-15(4-10-18)12-25-27-22(30)21(29)24-13-19-2-1-11-31-19/h3-10,12,19H,1-2,11,13-14H2,(H,24,29)(H,26,28)(H,27,30)/b25-12-/t19-/m0/s1 |
| InChIKey | RPPFOWBVUFXWOS-AXKQXYKKSA-N |
| XLogP | 2.10 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|