C24H28N4O7 — CID 94832912
N-(2,4-dimethoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 94832912) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94832912 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)NC[C@H]3CCCO3)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O7/c1-32-18-9-10-20(21(12-18)33-2)27-23(30)24(31)28-26-13-16-5-7-17(8-6-16)35-15-22(29)25-14-19-4-3-11-34-19/h5-10,12-13,19H,3-4,11,14-15H2,1-2H3,(H,25,29)(H,27,30)(H,28,31)/b26-13-/t19-/m1/s1 |
| InChIKey | WNFYFQIKFHMKGY-KSMZKSHNSA-N |
| XLogP | 1.47 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|