C22H25N5O5 — CID 94832476
N'-[(Z)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 94832476) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 94832476 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N'-[(Z)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)NCc2ccccn2)cc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H25N5O5/c28-20(24-14-19-5-3-11-31-19)15-32-18-8-6-16(7-9-18)12-26-27-22(30)21(29)25-13-17-4-1-2-10-23-17/h1-2,4,6-10,12,19H,3,5,11,13-15H2,(H,24,28)(H,25,29)(H,27,30)/b26-12-/t19-/m0/s1 |
| InChIKey | VISMFLCOXGLPRF-ZRNHNWMXSA-N |
| XLogP | 0.52 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|