C29H32N4O6S — CID 98063648
2-[benzenesulfonyl(benzyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 98063648) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98063648 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2ccccc2)cc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H32N4O6S/c34-28(21-33(20-24-8-3-1-4-9-24)40(36,37)27-11-5-2-6-12-27)32-31-18-23-13-15-25(16-14-23)39-22-29(35)30-19-26-10-7-17-38-26/h1-6,8-9,11-16,18,26H,7,10,17,19-22H2,(H,30,35)(H,32,34)/b31-18+/t26-/m0/s1 |
| InChIKey | MGDKVLWGJVHDFC-IAEWTUJKSA-N |
| XLogP | 2.70 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|