C25H24FN3O6S — CID 94838392
methyl 2-[4-[(Z)-[[2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 94838392) has the molecular formula C25H24FN3O6S and a molecular weight of 513.55 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 94838392 |
| Molecular Formula | C25H24FN3O6S |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(2-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N\NC(=O)CN(c2ccccc2F)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H24FN3O6S/c1-18-7-13-21(14-8-18)36(32,33)29(23-6-4-3-5-22(23)26)16-24(30)28-27-15-19-9-11-20(12-10-19)35-17-25(31)34-2/h3-15H,16-17H2,1-2H3,(H,28,30)/b27-15- |
| InChIKey | WETQNHYDWDDLBP-DICXZTSXSA-N |
| XLogP | 3.03 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|