C31H29ClN4O7S — CID 124631557
2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124631557) has the molecular formula C31H29ClN4O7S and a molecular weight of 637.11 g/mol. Its IUPAC name is 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124631557 |
| Molecular Formula | C31H29ClN4O7S |
| Molecular Weight | 637.11 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)CN(c3ccc(Cl)cc3)S(=O)(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H29ClN4O7S/c1-41-26-13-7-24(8-14-26)34-31(38)21-43-28-11-3-22(4-12-28)19-33-35-30(37)20-36(25-9-5-23(32)6-10-25)44(39,40)29-17-15-27(42-2)16-18-29/h3-19H,20-21H2,1-2H3,(H,34,38)(H,35,37)/b33-19- |
| InChIKey | RAWYOIBSJSVVIF-APTWKGOFSA-N |
| XLogP | 4.72 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.11 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|