C32H31ClN4O8S — CID 99681502
N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide (PubChem CID 99681502) has the molecular formula C32H31ClN4O8S and a molecular weight of 667.14 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 99681502 |
| Molecular Formula | C32H31ClN4O8S |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C\c2ccc(OCC(=O)Nc3ccccc3Cl)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H31ClN4O8S/c1-42-24-14-10-23(11-15-24)37(46(40,41)26-16-17-29(43-2)30(18-26)44-3)20-31(38)36-34-19-22-8-12-25(13-9-22)45-21-32(39)35-28-7-5-4-6-27(28)33/h4-19H,20-21H2,1-3H3,(H,35,39)(H,36,38)/b34-19- |
| InChIKey | QXBLZIHDCFVGFC-FZKWRIDDSA-N |
| XLogP | 4.73 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|