C31H28ClFN4O7S — CID 126116982
N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 126116982) has the molecular formula C31H28ClFN4O7S and a molecular weight of 655.10 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 126116982 |
| Molecular Formula | C31H28ClFN4O7S |
| Molecular Weight | 655.10 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)Nc3ccccc3Cl)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C31H28ClFN4O7S/c1-42-28-16-15-25(17-29(28)43-2)45(40,41)37(23-11-9-22(33)10-12-23)19-30(38)36-34-18-21-7-13-24(14-8-21)44-20-31(39)35-27-6-4-3-5-26(27)32/h3-18H,19-20H2,1-2H3,(H,35,39)(H,36,38)/b34-18- |
| InChIKey | FSVRZSJZGAMFPV-HQDYHJHZSA-N |
| XLogP | 4.86 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.10 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|