C31H35FN4O7S — CID 126117514
N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 126117514) has the molecular formula C31H35FN4O7S and a molecular weight of 626.71 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 126117514 |
| Molecular Formula | C31H35FN4O7S |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)NC3CCCCC3)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C31H35FN4O7S/c1-41-28-17-16-27(18-29(28)42-2)44(39,40)36(25-12-10-23(32)11-13-25)20-30(37)35-33-19-22-8-14-26(15-9-22)43-21-31(38)34-24-6-4-3-5-7-24/h8-19,24H,3-7,20-21H2,1-2H3,(H,34,38)(H,35,37)/b33-19- |
| InChIKey | ATBLXLJUZKTMOY-APTWKGOFSA-N |
| XLogP | 4.02 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|