C24H29IN4O5S — CID 126035170
N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 126035170) has the molecular formula C24H29IN4O5S and a molecular weight of 612.49 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126035170 |
| Molecular Formula | C24H29IN4O5S |
| Molecular Weight | 612.49 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(OCC(=O)NC2CCCCC2)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C24H29IN4O5S/c1-35(32,33)29(21-11-9-19(25)10-12-21)16-23(30)28-26-15-18-7-13-22(14-8-18)34-17-24(31)27-20-5-3-2-4-6-20/h7-15,20H,2-6,16-17H2,1H3,(H,27,31)(H,28,30)/b26-15- |
| InChIKey | QXANRCIEGKOZHM-YSMPRRRNSA-N |
| XLogP | 3.04 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|