C24H34N4O4 — CID 3829252
N-cyclohexyl-N'-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide (PubChem CID 3829252) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-cyclohexyl-N'-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-cyclohexyl-N'-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3829252 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-cyclohexyl-N'-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)NC1CCCCC1)NN=Cc1ccc(OCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N4O4/c29-22(26-19-7-3-1-4-8-19)15-23(30)28-25-16-18-11-13-21(14-12-18)32-17-24(31)27-20-9-5-2-6-10-20/h11-14,16,19-20H,1-10,15,17H2,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | BVVDIEXHZLSISB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|