C17H22N4O4 — CID 94863520
N'-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-cyclohexyloxamide (PubChem CID 94863520) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-cyclohexyloxamide.
| Compound Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-cyclohexyloxamide |
|---|---|
| PubChem CID | 94863520 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-cyclohexyloxamide |
| SMILES | NC(=O)COc1ccc(/C=N\NC(=O)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C17H22N4O4/c18-15(22)11-25-14-8-6-12(7-9-14)10-19-21-17(24)16(23)20-13-4-2-1-3-5-13/h6-10,13H,1-5,11H2,(H2,18,22)(H,20,23)(H,21,24)/b19-10- |
| InChIKey | GNGVOOBJTXUAKJ-GRSHGNNSSA-N |
| XLogP | 0.45 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|