C20H28N4O4 — CID 94863500
N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 94863500) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 94863500 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C\c1ccc(OCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H28N4O4/c1-14(2)22-19(26)20(27)24-21-12-15-8-10-17(11-9-15)28-13-18(25)23-16-6-4-3-5-7-16/h8-12,14,16H,3-7,13H2,1-2H3,(H,22,26)(H,23,25)(H,24,27)/b21-12- |
| InChIKey | QBJLAGOQLSEBTR-MTJSOVHGSA-N |
| XLogP | 1.49 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|