C24H29N3O5 — CID 6035728
N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 6035728) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 6035728 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C\c2ccc(OCC(=O)NC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-30-21-12-18(13-22(14-21)31-2)24(29)27-25-15-17-8-10-20(11-9-17)32-16-23(28)26-19-6-4-3-5-7-19/h8-15,19H,3-7,16H2,1-2H3,(H,26,28)(H,27,29)/b25-15- |
| InChIKey | BCYUUXYACCXSCX-MYYYXRDXSA-N |
| XLogP | 3.30 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|