C16H20ClN3O2 — CID 21211605
N'-[(E)-(3-chlorophenyl)methylideneamino]-N-cyclohexylpropanediamide (PubChem CID 21211605) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N'-[(E)-(3-chlorophenyl)methylideneamino]-N-cyclohexylpropanediamide.
| Compound Name | N'-[(E)-(3-chlorophenyl)methylideneamino]-N-cyclohexylpropanediamide |
|---|---|
| PubChem CID | 21211605 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N'-[(E)-(3-chlorophenyl)methylideneamino]-N-cyclohexylpropanediamide |
| SMILES | O=C(CC(=O)NC1CCCCC1)N/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-13-6-4-5-12(9-13)11-18-20-16(22)10-15(21)19-14-7-2-1-3-8-14/h4-6,9,11,14H,1-3,7-8,10H2,(H,19,21)(H,20,22)/b18-11+ |
| InChIKey | IJVUHTBMDXTFOE-WOJGMQOQSA-N |
| XLogP | 2.63 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|