C30H33ClN4O5S — CID 43879830
4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(E)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 43879830) has the molecular formula C30H33ClN4O5S and a molecular weight of 597.14 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(E)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(E)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 43879830 |
| Molecular Formula | C30H33ClN4O5S |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(E)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1Cl)c1ccc(C(=O)N/N=C/c2ccc(OCC(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H33ClN4O5S/c1-41(38,39)35(20-24-7-5-6-10-28(24)31)26-15-13-23(14-16-26)30(37)34-32-19-22-11-17-27(18-12-22)40-21-29(36)33-25-8-3-2-4-9-25/h5-7,10-19,25H,2-4,8-9,20-21H2,1H3,(H,33,36)(H,34,37)/b32-19+ |
| InChIKey | FUJZAUQTISTUSM-BIZUNTBRSA-N |
| XLogP | 4.90 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|