C26H29ClN4O3S — CID 94838491
4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide (PubChem CID 94838491) has the molecular formula C26H29ClN4O3S and a molecular weight of 513.06 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 94838491 |
| Molecular Formula | C26H29ClN4O3S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)c2ccc(N(Cc3ccccc3Cl)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H29ClN4O3S/c1-4-30(5-2)23-14-10-20(11-15-23)18-28-29-26(32)21-12-16-24(17-13-21)31(35(3,33)34)19-22-8-6-7-9-25(22)27/h6-18H,4-5,19H2,1-3H3,(H,29,32)/b28-18- |
| InChIKey | XJEOLXPGDQKDTM-VEILYXNESA-N |
| XLogP | 4.92 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|