C27H32N4O — CID 6900909
N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-(diethylamino)benzamide (PubChem CID 6900909) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-(diethylamino)benzamide.
| Compound Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-(diethylamino)benzamide |
|---|---|
| PubChem CID | 6900909 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-(diethylamino)benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)N/N=C/c2ccc(N(CC)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O/c1-4-30(5-2)25-18-14-24(15-19-25)27(32)29-28-20-22-12-16-26(17-13-22)31(6-3)21-23-10-8-7-9-11-23/h7-20H,4-6,21H2,1-3H3,(H,29,32)/b28-20+ |
| InChIKey | FLBDLIRWQNSLBW-VFCFBJKWSA-N |
| XLogP | 5.32 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|