C19H22N4O2 — CID 164880526
4-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzene-1,4-dicarboxamide (PubChem CID 164880526) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 164880526 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzene-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-3-23(4-2)17-11-5-14(6-12-17)13-21-22-19(25)16-9-7-15(8-10-16)18(20)24/h5-13H,3-4H2,1-2H3,(H2,20,24)(H,22,25)/b21-13+ |
| InChIKey | IODDUEMCLUDRNF-FYJGNVAPSA-N |
| XLogP | 2.40 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|