C23H32N6O — CID 5335044
1,3-bis[(E)-[4-(diethylamino)phenyl]methylideneamino]urea (PubChem CID 5335044) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1,3-bis[(E)-[4-(diethylamino)phenyl]methylideneamino]urea.
| Compound Name | 1,3-bis[(E)-[4-(diethylamino)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 5335044 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1,3-bis[(E)-[4-(diethylamino)phenyl]methylideneamino]urea |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)N/N=C/c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C23H32N6O/c1-5-28(6-2)21-13-9-19(10-14-21)17-24-26-23(30)27-25-18-20-11-15-22(16-12-20)29(7-3)8-4/h9-18H,5-8H2,1-4H3,(H2,26,27,30)/b24-17+,25-18+ |
| InChIKey | UIYVOUDXHRERGA-WZGDJCGDSA-N |
| XLogP | 4.05 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|