C19H24N6O — CID 5355984
1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-[[4-(dimethylamino)phenyl]methylideneamino]urea (PubChem CID 5355984) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-[[4-(dimethylamino)phenyl]methylideneamino]urea.
| Compound Name | 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-[[4-(dimethylamino)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 5355984 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-[[4-(dimethylamino)phenyl]methylideneamino]urea |
| SMILES | CN(C)c1ccc(C=NNC(=O)N/N=C\c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N6O/c1-24(2)17-9-5-15(6-10-17)13-20-22-19(26)23-21-14-16-7-11-18(12-8-16)25(3)4/h5-14H,1-4H3,(H2,22,23,26)/b20-13-,21-14? |
| InChIKey | MFNUMNHZUBBQSG-ZTZLRSFLSA-N |
| XLogP | 2.49 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|