C23H23N3O — CID 5499697
N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 5499697) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5499697 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O/c1-26(2)21-15-13-18(14-16-21)17-24-25-23(27)22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-17,22H,1-2H3,(H,25,27)/b24-17- |
| InChIKey | YHTXNRWVUFOQED-ULJHMMPZSA-N |
| XLogP | 4.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|