C19H21BrN4O2 — CID 3874134
N-(2-bromophenyl)-N'-[[4-(dimethylamino)phenyl]methylideneamino]-2-methylpropanediamide (PubChem CID 3874134) has the molecular formula C19H21BrN4O2 and a molecular weight of 417.31 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[[4-(dimethylamino)phenyl]methylideneamino]-2-methylpropanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[[4-(dimethylamino)phenyl]methylideneamino]-2-methylpropanediamide |
|---|---|
| PubChem CID | 3874134 |
| Molecular Formula | C19H21BrN4O2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-(2-bromophenyl)-N'-[[4-(dimethylamino)phenyl]methylideneamino]-2-methylpropanediamide |
| SMILES | CC(C(=O)NN=Cc1ccc(N(C)C)cc1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C19H21BrN4O2/c1-13(18(25)22-17-7-5-4-6-16(17)20)19(26)23-21-12-14-8-10-15(11-9-14)24(2)3/h4-13H,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | YGANUJZRQSDOKJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|