C20H19Br2N3O3 — CID 4014543
N-(2-bromophenyl)-N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-2-methylpropanediamide (PubChem CID 4014543) has the molecular formula C20H19Br2N3O3 and a molecular weight of 509.20 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-2-methylpropanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-2-methylpropanediamide |
|---|---|
| PubChem CID | 4014543 |
| Molecular Formula | C20H19Br2N3O3 |
| Molecular Weight | 509.20 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | N-(2-bromophenyl)-N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-2-methylpropanediamide |
| SMILES | C=CCOc1ccc(C=NNC(=O)C(C)C(=O)Nc2ccccc2Br)cc1Br |
| InChI | InChI=1S/C20H19Br2N3O3/c1-3-10-28-18-9-8-14(11-16(18)22)12-23-25-20(27)13(2)19(26)24-17-7-5-4-6-15(17)21/h3-9,11-13H,1,10H2,2H3,(H,24,26)(H,25,27) |
| InChIKey | KFTWPSLDYVQXHT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|