C20H22BrN3O5 — CID 4285375
N-(2-bromophenyl)-2-methyl-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]propanediamide (PubChem CID 4285375) has the molecular formula C20H22BrN3O5 and a molecular weight of 464.32 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-methyl-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-bromophenyl)-2-methyl-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4285375 |
| Molecular Formula | C20H22BrN3O5 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N-(2-bromophenyl)-2-methyl-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]propanediamide |
| SMILES | COc1cc(C=NNC(=O)C(C)C(=O)Nc2ccccc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C20H22BrN3O5/c1-12(19(25)23-15-8-6-5-7-14(15)21)20(26)24-22-11-13-9-16(27-2)18(29-4)17(10-13)28-3/h5-12H,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | AVVKFHCJNVFUFU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|