C25H20BrN3O2 — CID 5224979
N-(anthracen-9-ylmethylideneamino)-N'-(2-bromophenyl)-2-methylpropanediamide (PubChem CID 5224979) has the molecular formula C25H20BrN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-N'-(2-bromophenyl)-2-methylpropanediamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-N'-(2-bromophenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 5224979 |
| Molecular Formula | C25H20BrN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-N'-(2-bromophenyl)-2-methylpropanediamide |
| SMILES | CC(C(=O)NN=Cc1c2ccccc2cc2ccccc12)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C25H20BrN3O2/c1-16(24(30)28-23-13-7-6-12-22(23)26)25(31)29-27-15-21-19-10-4-2-8-17(19)14-18-9-3-5-11-20(18)21/h2-16H,1H3,(H,28,30)(H,29,31) |
| InChIKey | WSEFFHZVWNKJIS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|