C24H19BrN2O2 — CID 129439639
(2S)-N-(anthracen-9-ylmethylideneamino)-2-(4-bromophenoxy)propanamide (PubChem CID 129439639) has the molecular formula C24H19BrN2O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is (2S)-N-(anthracen-9-ylmethylideneamino)-2-(4-bromophenoxy)propanamide.
| Compound Name | (2S)-N-(anthracen-9-ylmethylideneamino)-2-(4-bromophenoxy)propanamide |
|---|---|
| PubChem CID | 129439639 |
| Molecular Formula | C24H19BrN2O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (2S)-N-(anthracen-9-ylmethylideneamino)-2-(4-bromophenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(Br)cc1)C(=O)NN=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C24H19BrN2O2/c1-16(29-20-12-10-19(25)11-13-20)24(28)27-26-15-23-21-8-4-2-6-17(21)14-18-7-3-5-9-22(18)23/h2-16H,1H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | NQEGDNXMFIUDPP-INIZCTEOSA-N |
| XLogP | 5.67 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|