C16H13BrCl2N2O2 — CID 4671273
2-(4-bromophenoxy)-N-[(2,3-dichlorophenyl)methylideneamino]propanamide (PubChem CID 4671273) has the molecular formula C16H13BrCl2N2O2 and a molecular weight of 416.10 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(2,3-dichlorophenyl)methylideneamino]propanamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(2,3-dichlorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 4671273 |
| Molecular Formula | C16H13BrCl2N2O2 |
| Molecular Weight | 416.10 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(2,3-dichlorophenyl)methylideneamino]propanamide |
| SMILES | CC(Oc1ccc(Br)cc1)C(=O)NN=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H13BrCl2N2O2/c1-10(23-13-7-5-12(17)6-8-13)16(22)21-20-9-11-3-2-4-14(18)15(11)19/h2-10H,1H3,(H,21,22) |
| InChIKey | KSTGLQAFUTWIIO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|