C17H16BrClN2O2 — CID 1014694
(2R)-N-[(4-bromophenyl)methylideneamino]-2-(4-chloro-3-methylphenoxy)propanamide (PubChem CID 1014694) has the molecular formula C17H16BrClN2O2 and a molecular weight of 395.68 g/mol. Its IUPAC name is (2R)-N-[(4-bromophenyl)methylideneamino]-2-(4-chloro-3-methylphenoxy)propanamide.
| Compound Name | (2R)-N-[(4-bromophenyl)methylideneamino]-2-(4-chloro-3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 1014694 |
| Molecular Formula | C17H16BrClN2O2 |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | (2R)-N-[(4-bromophenyl)methylideneamino]-2-(4-chloro-3-methylphenoxy)propanamide |
| SMILES | Cc1cc(O[C@H](C)C(=O)NN=Cc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C17H16BrClN2O2/c1-11-9-15(7-8-16(11)19)23-12(2)17(22)21-20-10-13-3-5-14(18)6-4-13/h3-10,12H,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | DIFXENLKPRJNCI-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|