C16H14BrIN2O2 — CID 28839263
(2S)-2-(4-bromophenoxy)-N-[(Z)-(3-iodophenyl)methylideneamino]propanamide (PubChem CID 28839263) has the molecular formula C16H14BrIN2O2 and a molecular weight of 473.11 g/mol. Its IUPAC name is (2S)-2-(4-bromophenoxy)-N-[(Z)-(3-iodophenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-bromophenoxy)-N-[(Z)-(3-iodophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 28839263 |
| Molecular Formula | C16H14BrIN2O2 |
| Molecular Weight | 473.11 g/mol |
| Exact Mass | 471.93 |
| IUPAC Name | (2S)-2-(4-bromophenoxy)-N-[(Z)-(3-iodophenyl)methylideneamino]propanamide |
| SMILES | C[C@H](Oc1ccc(Br)cc1)C(=O)N/N=C\c1cccc(I)c1 |
| InChI | InChI=1S/C16H14BrIN2O2/c1-11(22-15-7-5-13(17)6-8-15)16(21)20-19-10-12-3-2-4-14(18)9-12/h2-11H,1H3,(H,20,21)/b19-10-/t11-/m0/s1 |
| InChIKey | OLHANECDRHTFTR-ORPVNXHJSA-N |
| XLogP | 3.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.11 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|