C11H12BrN3O2 — CID 71670057
[(Z)-(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]urea (PubChem CID 71670057) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is [(Z)-(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 71670057 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | [(Z)-(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]urea |
| SMILES | C=CCOc1ccc(/C=N\NC(N)=O)cc1Br |
| InChI | InChI=1S/C11H12BrN3O2/c1-2-5-17-10-4-3-8(6-9(10)12)7-14-15-11(13)16/h2-4,6-7H,1,5H2,(H3,13,15,16)/b14-7- |
| InChIKey | FOIAVEQCKZUDFQ-AUWJEWJLSA-N |
| XLogP | 2.02 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|