C14H19N3O2 — CID 168532903
[(4-propan-2-yloxy-3-prop-2-enylphenyl)methylideneamino]urea (PubChem CID 168532903) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(4-propan-2-yloxy-3-prop-2-enylphenyl)methylideneamino]urea.
| Compound Name | [(4-propan-2-yloxy-3-prop-2-enylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 168532903 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [(4-propan-2-yloxy-3-prop-2-enylphenyl)methylideneamino]urea |
| SMILES | C=CCc1cc(C=NNC(N)=O)ccc1OC(C)C |
| InChI | InChI=1S/C14H19N3O2/c1-4-5-12-8-11(9-16-17-14(15)18)6-7-13(12)19-10(2)3/h4,6-10H,1,5H2,2-3H3,(H3,15,17,18) |
| InChIKey | FBFUHNSEHKBMDZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|