C10H11F2N3O3 — CID 9017274
[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]urea (PubChem CID 9017274) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is [(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]urea.
| Compound Name | [(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 9017274 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]urea |
| SMILES | COc1ccc(/C=N\NC(N)=O)cc1OC(F)F |
| InChI | InChI=1S/C10H11F2N3O3/c1-17-7-3-2-6(5-14-15-10(13)16)4-8(7)18-9(11)12/h2-5,9H,1H3,(H3,13,15,16)/b14-5- |
| InChIKey | LMBOTFZRXLTYIX-RZNTYIFUSA-N |
| XLogP | 1.30 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|