C9H8F3N3O2 — CID 168534079
[[2-(difluoromethoxy)-5-fluorophenyl]methylideneamino]urea (PubChem CID 168534079) has the molecular formula C9H8F3N3O2 and a molecular weight of 247.18 g/mol. Its IUPAC name is [[2-(difluoromethoxy)-5-fluorophenyl]methylideneamino]urea.
| Compound Name | [[2-(difluoromethoxy)-5-fluorophenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168534079 |
| Molecular Formula | C9H8F3N3O2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [[2-(difluoromethoxy)-5-fluorophenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cc(F)ccc1OC(F)F |
| InChI | InChI=1S/C9H8F3N3O2/c10-6-1-2-7(17-8(11)12)5(3-6)4-14-15-9(13)16/h1-4,8H,(H3,13,15,16) |
| InChIKey | OHPNQZGXNBNZAI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|