C15H12BrF2N3O2 — CID 9070685
4-amino-N-[(Z)-[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]benzamide (PubChem CID 9070685) has the molecular formula C15H12BrF2N3O2 and a molecular weight of 384.18 g/mol. Its IUPAC name is 4-amino-N-[(Z)-[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9070685 |
| Molecular Formula | C15H12BrF2N3O2 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 4-amino-N-[(Z)-[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]benzamide |
| SMILES | Nc1ccc(C(=O)N/N=C\c2cc(Br)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C15H12BrF2N3O2/c16-11-3-6-13(23-15(17)18)10(7-11)8-20-21-14(22)9-1-4-12(19)5-2-9/h1-8,15H,19H2,(H,21,22)/b20-8- |
| InChIKey | NZRHLACFSLUKRH-ZBKNUEDVSA-N |
| XLogP | 3.40 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|