C16H14BrN3O4 — CID 44507819
1-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 44507819) has the molecular formula C16H14BrN3O4 and a molecular weight of 392.21 g/mol. Its IUPAC name is 1-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 44507819 |
| Molecular Formula | C16H14BrN3O4 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 1-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | COc1ccc(Br)cc1/C=N/NC(=O)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C16H14BrN3O4/c1-24-14-7-6-13(17)8-12(14)9-18-19-15(21)10-2-4-11(5-3-10)16(22)20-23/h2-9,23H,1H3,(H,19,21)(H,20,22)/b18-9+ |
| InChIKey | MVHRNMZVUBWCPP-GIJQJNRQSA-N |
| XLogP | 2.34 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|