C9H9BrFN3O — CID 168533953
[[2-(bromomethyl)-4-fluorophenyl]methylideneamino]urea (PubChem CID 168533953) has the molecular formula C9H9BrFN3O and a molecular weight of 274.09 g/mol. Its IUPAC name is [[2-(bromomethyl)-4-fluorophenyl]methylideneamino]urea.
| Compound Name | [[2-(bromomethyl)-4-fluorophenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533953 |
| Molecular Formula | C9H9BrFN3O |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | [[2-(bromomethyl)-4-fluorophenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(F)cc1CBr |
| InChI | InChI=1S/C9H9BrFN3O/c10-4-7-3-8(11)2-1-6(7)5-13-14-9(12)15/h1-3,5H,4H2,(H3,12,14,15) |
| InChIKey | ALPLWCLCTFPBGX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|